CAS 1256360-26-5 is the registry number for 3-Acetamido-4-methoxyphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1256360-26-5) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: DEPLTYWHYGOPPN-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | DEPLTYWHYGOPPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)NC(=O)C |
Computed by PubChem (NCBI)