cas: 1150271-60-5 — see every product listed under this CAS number, including other names
5-(Ethoxycarbonyl)thiophene-2-boronic acid, pinacol ester, 95%, 95% (CAS 1150271-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FPO-100mg |
| cas | 1150271-60-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2541.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 1150271-60-5) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: PYGJQRFSPUBYRG-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | PYGJQRFSPUBYRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(=O)OCC |
Computed by PubChem (NCBI)