cas: 1418117-78-8 — see every product listed under this CAS number, including other names
5-(Ethoxymethyl)-8-hydroxyquinoline Hydrochloride, >95%, >95% (CAS 1418117-78-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112H96-5g |
| cas | 1418117-78-8 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1528.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
5-(ethoxymethyl)quinolin-8-ol;hydrochloride (CAS 1418117-78-8) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: 5-(ethoxymethyl)quinolin-8-ol;hydrochloride. InChIKey: YLGAANZNAZEBOQ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 5-(ethoxymethyl)quinolin-8-ol;hydrochloride |
| InChIKey | YLGAANZNAZEBOQ-UHFFFAOYSA-N |
| SMILES | CCOCC1=C2C=CC=NC2=C(C=C1)O.Cl |
Computed by PubChem (NCBI)