cas: 21346-65-6 — see every product listed under this CAS number, including other names
5-(Fluorosulfonyl)-2-Methylbenzoic Acid, 95%, 95% (CAS 21346-65-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AML6-100mg |
| cas | 21346-65-6 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluorosulfonyl-2-methylbenzoic acid (CAS 21346-65-6) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 5-fluorosulfonyl-2-methylbenzoic acid. InChIKey: VORKXFBYNXMVJD-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 5-fluorosulfonyl-2-methylbenzoic acid |
| InChIKey | VORKXFBYNXMVJD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)