Products 383-38-0

CAS 383-38-0 is the registry number for (4-Fluoro-benzenesulfonyl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)sulfonylacetic acid (CAS 383-38-0) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 2-(4-fluorophenyl)sulfonylacetic acid. InChIKey: CMEDGBAZGURHOI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FO4S
Molecular weight218.20 g/mol
IUPAC name2-(4-fluorophenyl)sulfonylacetic acid
InChIKeyCMEDGBAZGURHOI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1F)S(=O)(=O)CC(=O)O

Computed by PubChem (NCBI)