cas: 913836-01-8 — see every product listed under this CAS number, including other names
5-(METHYLSULFONYL)PYRIDINE-3-BORONIC ACID, 97% (CAS 913836-01-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F808661-250MG |
| cas | 913836-01-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 100mg | 268.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(5-methylsulfonyl-3-pyridinyl)boronic acid (CAS 913836-01-8) is a chemical compound with the molecular formula C6H8BNO4S and a molecular weight of 201.01 g/mol. IUPAC name: (5-methylsulfonyl-3-pyridinyl)boronic acid. InChIKey: YGXNPQDXWDCWET-UHFFFAOYSA-N.
| Molecular formula | C6H8BNO4S |
|---|---|
| Molecular weight | 201.01 g/mol |
| IUPAC name | (5-methylsulfonyl-3-pyridinyl)boronic acid |
| InChIKey | YGXNPQDXWDCWET-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)