CAS 913836-01-8 appears in our catalog under these names: 5-(Methylsulfonyl)pyridine-3-boronic acid, 98%, 5-(Methylsulfonyl)pyridine-3-boronic acid, 98% , 5-(Methylsulphonyl)pyridine-3-boronic acid 98%, 5-(Methylsulfonyl)pyridine-3-boronic acid, 98%, 98%, 5-(METHYLSULFONYL)PYRIDINE-3-BORONIC ACID, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(5-methylsulfonyl-3-pyridinyl)boronic acid (CAS 913836-01-8) is a chemical compound with the molecular formula C6H8BNO4S and a molecular weight of 201.01 g/mol. IUPAC name: (5-methylsulfonyl-3-pyridinyl)boronic acid. InChIKey: YGXNPQDXWDCWET-UHFFFAOYSA-N.
| Molecular formula | C6H8BNO4S |
|---|---|
| Molecular weight | 201.01 g/mol |
| IUPAC name | (5-methylsulfonyl-3-pyridinyl)boronic acid |
| InChIKey | YGXNPQDXWDCWET-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)