cas: 468718-16-3 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)-1H-indole-3-carbaldehyde 97% (CAS 468718-16-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A701887-100mg |
| cas | 468718-16-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1171.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A701887 |
5-(trifluoromethyl)-1H-indole-3-carbaldehyde (CAS 468718-16-3) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-indole-3-carbaldehyde. InChIKey: ABXIESRZLRQYLM-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-indole-3-carbaldehyde |
| InChIKey | ABXIESRZLRQYLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=CN2)C=O |
Computed by PubChem (NCBI)