5-(Trifluoromethyl)indoline-2,3-dione, 98%
cas: 345-32-4 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)indoline-2,3-dione, 98% (CAS 345-32-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A329464-250mg |
| cas | 345-32-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 765.31 Pln | |
| Ambeed | 5g | 2155.94 Pln | |
| Ambeed | 10g | 3707.88 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2162.00 Pln | |
| Chemat | 10g | 3726.80 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 819.74 Pln | |
| BLDpharm | 5g | 2319.21 Pln | |
| BLDpharm | 10g | 3996.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-(trifluoromethyl)-1H-indole-2,3-dione (CAS 345-32-4) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-indole-2,3-dione. InChIKey: WODYULWWVAMDCP-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-indole-2,3-dione |
| InChIKey | WODYULWWVAMDCP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)