Products 345-32-4
CAS 345-32-4 appears in our catalog under these names: 5-(Trifluoromethyl)-1H-indole-2,3-dione, 95%, 5-(Trifluoromethyl)isatin, 5-(Trifluoromethyl)indoline-2,3-dione 98%, 5-(Trifluoromethyl)indoline-2,3-dione, 98%, 98%, 5-(Trifluoromethyl)-1H-indole-2,3-dione, ≥95.0%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 0,5g, 0,25g, 2g, 250mg.
5-(trifluoromethyl)-1H-indole-2,3-dione (CAS 345-32-4) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-indole-2,3-dione. InChIKey: WODYULWWVAMDCP-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-indole-2,3-dione |
| InChIKey | WODYULWWVAMDCP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)