cas: 924304-74-5 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)isoindoline hydrochloride 95% (CAS 924304-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A704553-100mg |
| cas | 924304-74-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1115.75 Pln | |
| Ambeed | 250mg | 1905.62 Pln | |
| Ambeed | 1g | 5410.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A704553 |
5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride (CAS 924304-74-5) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: SQCXNEZUTMIRGM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | SQCXNEZUTMIRGM-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)