CAS 924304-74-5 appears in our catalog under these names: 5-(Trifluoromethyl)isoindoline hydrochloride, 95%, 5-(Trifluoromethyl)isoindoline hydrochloride 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride (CAS 924304-74-5) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: SQCXNEZUTMIRGM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | SQCXNEZUTMIRGM-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)