cas: 128009-32-5 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)thiophene-2-carboxylic acid 95% (CAS 128009-32-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A903038-250mg |
| cas | 128009-32-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 3274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A903038 |
5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 128009-32-5) is a chemical compound with the molecular formula C6H3F3O2S and a molecular weight of 196.15 g/mol. IUPAC name: 5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: MTPNYGZXGMOELX-UHFFFAOYSA-N.
| Molecular formula | C6H3F3O2S |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 5-(trifluoromethyl)thiophene-2-carboxylic acid |
| InChIKey | MTPNYGZXGMOELX-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)