CAS 767337-58-6 appears in our catalog under these names: 2-(Trifluoromethyl)thiophene-3-carboxylic acid, 95%, 2–(Trifluoromethyl)thiophene–3–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-(trifluoromethyl)thiophene-3-carboxylic acid (CAS 767337-58-6) is a chemical compound with the molecular formula C6H3F3O2S and a molecular weight of 196.15 g/mol. IUPAC name: 2-(trifluoromethyl)thiophene-3-carboxylic acid. InChIKey: YPFJKHXREWOWKC-UHFFFAOYSA-N.
| Molecular formula | C6H3F3O2S |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 2-(trifluoromethyl)thiophene-3-carboxylic acid |
| InChIKey | YPFJKHXREWOWKC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)