cas: 152879-73-7 — see every product listed under this CAS number, including other names
5-(methylsulfonyl)-1H-indole, 97%, 97% (CAS 152879-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AN9A-100mg |
| cas | 152879-73-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 500mg | 1096.40 Pln | |
| Chemat | 1g | 1595.60 Pln | |
| Chemat | 5g | 7077.20 Pln | |
| Chemat | 10g | 11776.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methylsulfonyl-1H-indole (CAS 152879-73-7) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 5-methylsulfonyl-1H-indole. InChIKey: MEUDJQUMQJEWMB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5-methylsulfonyl-1H-indole |
| InChIKey | MEUDJQUMQJEWMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)