cas: 17509-21-6 — see every product listed under this CAS number, including other names
5-(p-Tolyl)thieno[2,3-d]pyrimidin-4(3H)-one 95% (CAS 17509-21-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1061144-50mg |
| cas | 17509-21-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 503.88 Pln | |
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 960.00 Pln | |
| Ambeed | 1g | 2295.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1061144 |
5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 17509-21-6) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: JYFIHIWXQSVJIL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | JYFIHIWXQSVJIL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)