CAS 17509-21-6 appears in our catalog under these names: 5-(4-Methylphenyl)-3h,4h-thieno[2,3-d]pyrimidin-4-one, 95%, 5-(p-Tolyl)thieno(2,3-d)pyrimidin-4(3H)-one, 95%, 5-(4-Methylphenyl)-3H,4H-thieno(2,3-d)pyrimidin-4-one, 5-(p-Tolyl)thieno[2,3-d]pyrimidin-4(3H)-one 95%. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g, 50mg.
5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 17509-21-6) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: JYFIHIWXQSVJIL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | JYFIHIWXQSVJIL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)