cas: 1218790-03-4 — see every product listed under this CAS number, including other names
5-(t-Butylcarbamoyl)pyridine-3-boronic acid, pinacol ester, 95%, 95% (CAS 1218790-03-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112793-100mg |
| cas | 1218790-03-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (CAS 1218790-03-4) is a chemical compound with the molecular formula C16H25BN2O3 and a molecular weight of 304.2 g/mol. IUPAC name: N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide. InChIKey: POBNCDYVYRUCQZ-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| InChIKey | POBNCDYVYRUCQZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)