cas: 1209492-73-8 — see every product listed under this CAS number, including other names
5-(tert-Butoxycarbonyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxylic acid, 98%, 98% (CAS 1209492-73-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TPE-100mg |
| cas | 1209492-73-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2958.80 Pln | |
| Chemat | 10g | 5435.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylic acid (CAS 1209492-73-8) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylic acid. InChIKey: QIUBDRRELVWSKR-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylic acid |
| InChIKey | QIUBDRRELVWSKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=CC(=N2)C(=O)O)C1 |
Computed by PubChem (NCBI)