5-(tert-Butyl) 1-ethyl 2,2-difluoropentanedioate, 95%
cas: 1782101-23-8 — see every product listed under this CAS number, including other names
5-(tert-Butyl) 1-ethyl 2,2-difluoropentanedioate, 95% (CAS 1782101-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1380112-1g |
| cas | 1782101-23-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2105.88 Pln | |
| Ambeed | 10g | 3485.38 Pln | |
| Ambeed | 25g | 6895.19 Pln | |
| BLDpharm | 1g | 780.86 Pln | |
| BLDpharm | 5g | 2269.23 Pln | |
| BLDpharm | 10g | 3752.04 Pln | |
| BLDpharm | 25g | 7428.52 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 2992.40 Pln | |
| Chemat | 10g | 4941.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-O-tert-butyl 1-O-ethyl 2,2-difluoropentanedioate (CAS 1782101-23-8) is a chemical compound with the molecular formula C11H18F2O4 and a molecular weight of 252.25 g/mol. IUPAC name: 5-O-tert-butyl 1-O-ethyl 2,2-difluoropentanedioate. InChIKey: FPMMELFOLPHKFK-UHFFFAOYSA-N.
| Molecular formula | C11H18F2O4 |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-ethyl 2,2-difluoropentanedioate |
| InChIKey | FPMMELFOLPHKFK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCC(=O)OC(C)(C)C)(F)F |
Computed by PubChem (NCBI)
Synonyms:
5-(tert-Butyl) 1-ethyl 2,2-difluoropentanedioate, 5-tert-Butyl 1-ethyl 2,2-difluoropentanedioate, 5-(1,1-Dimethylethyl) 1-ethyl 2,2-difluoropentanedioate, FPMMELFOLPHKFK-UHFFFAOYSA-N, 5-O-tert-butyl 1-O-ethyl 2,2-difluoropentanedioate, Pentanedioic acid, 2,2-difluoro-, 5-(1,1-dimethylethyl) 1-ethyl ester