CAS 22515-16-8 appears in our catalog under these names: Diethyl 4,4-difluoropimelate, 97% , Diethyl 4,4-difluoroheptanedioate 97%, Diethyl 4,4-difluoroheptanedioate, 97%, 97%, DIETHYL 4,4-DIFLUOROHEPTANEDIOATE, 96%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
Diethyl 4,4-difluoroheptanedioate (CAS 22515-16-8) is a chemical compound with the molecular formula C11H18F2O4 and a molecular weight of 252.25 g/mol. IUPAC name: diethyl 4,4-difluoroheptanedioate. InChIKey: XUOBBVMKXUPPEW-UHFFFAOYSA-N.
| Molecular formula | C11H18F2O4 |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | diethyl 4,4-difluoroheptanedioate |
| InChIKey | XUOBBVMKXUPPEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(CCC(=O)OCC)(F)F |
Computed by PubChem (NCBI)