cas: 29212-25-7 — see every product listed under this CAS number, including other names
5-(tert-Butyl)thiophene-2-carboxylic acid 98% (CAS 29212-25-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A388766-25g |
| cas | 29212-25-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 3162.75 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 815.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A388766 |
5-tert-butylthiophene-2-carboxylic acid (CAS 29212-25-7) is a chemical compound with the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. IUPAC name: 5-tert-butylthiophene-2-carboxylic acid. InChIKey: BJDXNKJQTLSJPM-UHFFFAOYSA-N.
| Molecular formula | C9H12O2S |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | 5-tert-butylthiophene-2-carboxylic acid |
| InChIKey | BJDXNKJQTLSJPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(S1)C(=O)O |
Computed by PubChem (NCBI)