CAS 29212-25-7 appears in our catalog under these names: 5-tert-Butylthiophene-2-carboxylic acid, 98%, 5–tert–Butylthiophene–2–carboxylic acid, 5-tert-Butylthiophene-2-carboxylic acid, 5-(tert-Butyl)thiophene-2-carboxylic acid 98%, 5-tert-Butyl-thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
5-tert-butylthiophene-2-carboxylic acid (CAS 29212-25-7) is a chemical compound with the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. IUPAC name: 5-tert-butylthiophene-2-carboxylic acid. InChIKey: BJDXNKJQTLSJPM-UHFFFAOYSA-N.
| Molecular formula | C9H12O2S |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | 5-tert-butylthiophene-2-carboxylic acid |
| InChIKey | BJDXNKJQTLSJPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(S1)C(=O)O |
Computed by PubChem (NCBI)