cas: 1280214-48-3 — see every product listed under this CAS number, including other names
5-[(2-Methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylic acid, 97% (CAS 1280214-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601669-100MG |
| cas | 1280214-48-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1528.65 Pln | |
| Fluorochem | 1g | 3970.49 Pln | |
| Fluorochem | 5g | 11624.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylic acid (CAS 1280214-48-3) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylic acid. InChIKey: XFFLLSTVIDHWSN-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxylic acid |
| InChIKey | XFFLLSTVIDHWSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=C(C=N2)C(=O)O)C1 |
Computed by PubChem (NCBI)