cas: 302911-88-2 — see every product listed under this CAS number, including other names
5-[2-Chloro-5-(trifluoromethyl)phenyl]-2-furancarboxylic acid, 96%, 96% (CAS 302911-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZHL-250mg |
| cas | 302911-88-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 496.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid (CAS 302911-88-2) is a chemical compound with the molecular formula C12H6ClF3O3 and a molecular weight of 290.62 g/mol. IUPAC name: 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid. InChIKey: SSIFVNBQAZVYCS-UHFFFAOYSA-N.
| Molecular formula | C12H6ClF3O3 |
|---|---|
| Molecular weight | 290.62 g/mol |
| IUPAC name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
| InChIKey | SSIFVNBQAZVYCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)