CAS 302911-88-2 appears in our catalog under these names: 5-[2-Chloro-5-(trifluoromethyl)phenyl]-2-furoic acid, 95%, 5-(2-Chloro-5-(trifluoromethyl)phenyl)furan-2-carboxylic acid 95%, 5-[2-Chloro-5-(trifluoromethyl)phenyl]-2-furancarboxylic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid (CAS 302911-88-2) is a chemical compound with the molecular formula C12H6ClF3O3 and a molecular weight of 290.62 g/mol. IUPAC name: 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid. InChIKey: SSIFVNBQAZVYCS-UHFFFAOYSA-N.
| Molecular formula | C12H6ClF3O3 |
|---|---|
| Molecular weight | 290.62 g/mol |
| IUPAC name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
| InChIKey | SSIFVNBQAZVYCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)