CAS 638160-01-7 appears in our catalog under these names: 5–(4–(Trifluoromethoxy)phenyl)furan–2–carboxylic Acid, 5-[4-(Trifluoromethoxy)phenyl]furan-2-carboxylic Acid, ≥95%, ≥95%, 5-[4-(Trifluoromethoxy)phenyl]furan-2-carboxylic Acid, ≥95%, 5-[4-(Trifluoromethoxy)phenyl]furan-2-carboxylic Acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-[4-(trifluoromethoxy)phenyl]furan-2-carboxylic acid (CAS 638160-01-7) is a chemical compound with the molecular formula C12H7F3O4 and a molecular weight of 272.18 g/mol. IUPAC name: 5-[4-(trifluoromethoxy)phenyl]furan-2-carboxylic acid. InChIKey: KHCLEQZLFHIDBP-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O4 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | 5-[4-(trifluoromethoxy)phenyl]furan-2-carboxylic acid |
| InChIKey | KHCLEQZLFHIDBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)