CAS 424817-26-5 appears in our catalog under these names: 5-(2-(Trifluoromethoxy)phenyl)-2-furancarboxylic Acid, 5-(2-(Trifluoromethoxy)phenyl)furan-2-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 10g, 100mg, 1g.
5-[2-(trifluoromethoxy)phenyl]furan-2-carboxylic acid (CAS 424817-26-5) is a chemical compound with the molecular formula C12H7F3O4 and a molecular weight of 272.18 g/mol. IUPAC name: 5-[2-(trifluoromethoxy)phenyl]furan-2-carboxylic acid. InChIKey: PSLFQKRPFOCZHR-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O4 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | 5-[2-(trifluoromethoxy)phenyl]furan-2-carboxylic acid |
| InChIKey | PSLFQKRPFOCZHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)