cas: 6659-92-3 — see every product listed under this CAS number, including other names
5-Amino-2-(4-methoxyphenyl)-2H-benzotriazole, 96%+(LC-MS),RG, 96%+(LC-MS),RG (CAS 6659-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAON-100mg |
| cas | 6659-92-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2027.60 Pln |
| purity | 96%+(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenyl)benzotriazol-5-amine (CAS 6659-92-3) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 2-(4-methoxyphenyl)benzotriazol-5-amine. InChIKey: WNZKUNXGRZGIFX-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)benzotriazol-5-amine |
| InChIKey | WNZKUNXGRZGIFX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2N=C3C=CC(=CC3=N2)N |
Computed by PubChem (NCBI)