cas: 104460-69-7 — see every product listed under this CAS number, including other names
5-Amino-2-bromo-4-chlorobenzotrifluoride (CAS 104460-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038767-1G |
| cas | 104460-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 1268.32 Pln | |
| Fluorochem | 10g | 2106.57 Pln |
| delivery time | 2-3 weeks |
|---|
4-bromo-2-chloro-5-(trifluoromethyl)aniline (CAS 104460-69-7) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-(trifluoromethyl)aniline. InChIKey: LPTLQQLBRJFBIN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-(trifluoromethyl)aniline |
| InChIKey | LPTLQQLBRJFBIN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)