cas: 1052714-41-6 — see every product listed under this CAS number, including other names
5-Amino-2-chloropyrimidine-4-carboxylic acid 98% (CAS 1052714-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466621-100mg |
| cas | 1052714-41-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 2139.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A466621 |
5-amino-2-chloropyrimidine-4-carboxylic acid (CAS 1052714-41-6) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 5-amino-2-chloropyrimidine-4-carboxylic acid. InChIKey: YFZBEXPQXKNNGJ-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 5-amino-2-chloropyrimidine-4-carboxylic acid |
| InChIKey | YFZBEXPQXKNNGJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)C(=O)O)N |
Computed by PubChem (NCBI)