cas: 851175-92-3 — see every product listed under this CAS number, including other names
5-Amino-2-methoxy-N,N-dimethylbenzenesulfonamide, 98%, 98% (CAS 851175-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0M5-100mg |
| cas | 851175-92-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1499.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-amino-2-methoxy-N,N-dimethylbenzenesulfonamide (CAS 851175-92-3) is a chemical compound with the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. IUPAC name: 5-amino-2-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: DYLCFQPSHBRELT-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 5-amino-2-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | DYLCFQPSHBRELT-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)N)OC |
Computed by PubChem (NCBI)