CAS 7400-96-6 appears in our catalog under these names: 3-Amino-4-methoxy-N,N-dimethyl-benzenesulfonamide, 98%, 3-Amino-4-methoxy-n,n-dimethyl-benzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
3-amino-4-methoxy-N,N-dimethylbenzenesulfonamide (CAS 7400-96-6) is a chemical compound with the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. IUPAC name: 3-amino-4-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: LEDOHLBFUWTDPD-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 3-amino-4-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | LEDOHLBFUWTDPD-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)OC)N |
Computed by PubChem (NCBI)