cas: 88508-44-5 — see every product listed under this CAS number, including other names
5-Amino-2-methoxybenzenesulfonamide, 95+%, 95+% (CAS 88508-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1150CY-100mg |
| cas | 88508-44-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 702.80 Pln | |
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 1g | 2282.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5-amino-2-methoxybenzenesulfonamide (CAS 88508-44-5) is a chemical compound with the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. IUPAC name: 5-amino-2-methoxybenzenesulfonamide. InChIKey: VYYZMIPOAWOHAI-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 5-amino-2-methoxybenzenesulfonamide |
| InChIKey | VYYZMIPOAWOHAI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)S(=O)(=O)N |
Computed by PubChem (NCBI)