CAS 1609400-95-4 is the registry number for 3-Methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrate (CAS 1609400-95-4) is a chemical compound with the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. IUPAC name: 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrate. InChIKey: MVXLHXRZDTXKAA-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrate |
| InChIKey | MVXLHXRZDTXKAA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NCCN12)C(=O)O.O |
Computed by PubChem (NCBI)