cas: 1330766-02-3 — see every product listed under this CAS number, including other names
5-BOC-5-AZASPIRO[2.4]HEPTANE-1-METHANOL, 97% (CAS 1330766-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467692-100MG |
| cas | 1330766-02-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1408.90 Pln | |
| Fluorochem | 250mg | 2205.49 Pln | |
| Fluorochem | 500mg | 3621.66 Pln | |
| Fluorochem | 1g | 5381.46 Pln | |
| Fluorochem | 5g | 15997.51 Pln | |
| Fluorochem | 10g | 26623.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate (CAS 1330766-02-3) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 2-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate. InChIKey: CJKAAFNTBCOVOE-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 2-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate |
| InChIKey | CJKAAFNTBCOVOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CC2CO |
Computed by PubChem (NCBI)