Products 539823-26-2

CAS 539823-26-2 is the registry number for Cis-(6-hydroxymethyl-cyclohex-3-enyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]carbamate (CAS 539823-26-2) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl N-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]carbamate. InChIKey: ZDQAKBPTCCHWIB-UWVGGRQHSA-N.

Identity
Molecular formulaC12H21NO3
Molecular weight227.30 g/mol
IUPAC nametert-butyl N-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]carbamate
InChIKeyZDQAKBPTCCHWIB-UWVGGRQHSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CC=CC[C@H]1CO

Computed by PubChem (NCBI)