5-Boronoisophthalic acid, 97%, 97%
cas: 881302-73-4 — see every product listed under this CAS number, including other names
5-Boronoisophthalic acid, 97%, 97% (CAS 881302-73-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119C8F-250mg |
| cas | 881302-73-4 |
| size | 250mg |
| availability | 900g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 818.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-boronobenzene-1,3-dicarboxylic acid (CAS 881302-73-4) is a chemical compound with the molecular formula C8H7BO6 and a molecular weight of 209.95 g/mol. IUPAC name: 5-boronobenzene-1,3-dicarboxylic acid. InChIKey: LCDXMCXNZRXUDH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO6 |
|---|---|
| Molecular weight | 209.95 g/mol |
| IUPAC name | 5-boronobenzene-1,3-dicarboxylic acid |
| InChIKey | LCDXMCXNZRXUDH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dicarboxyphenylboronic acid, 5-boronoisophthalic acid, 3,5-Dicarboxybenzeneboronic acid, 5-boronobenzene-1,3-dicarboxylic acid, 5-boronoisophthalicacid, 3,5-Dicarboxyphenylboronic Acid (contains varying amounts of Anhydride), 1,3-Benzenedicarboxylic acid, 5-borono-, 3,5-Dicarboxyphenylboronic, 3,5-Dicarboxyphenylboronic acid(contains varying amounts of Anhydride)