Products 881302-73-4
CAS 881302-73-4 appears in our catalog under these names: 3,5-Dicarboxyphenylboronic acid, 98%, 3,5–Dicarboxyphenylboronic acid(contains varying amounts of Anhydride), 3,5-Dicarboxyphenylboronic Acid (contains varying amounts of Anhydride), 5-Boronoisophthalic acid 97%, 5-Boronoisophthalic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg.
5-boronobenzene-1,3-dicarboxylic acid (CAS 881302-73-4) is a chemical compound with the molecular formula C8H7BO6 and a molecular weight of 209.95 g/mol. IUPAC name: 5-boronobenzene-1,3-dicarboxylic acid. InChIKey: LCDXMCXNZRXUDH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO6 |
|---|---|
| Molecular weight | 209.95 g/mol |
| IUPAC name | 5-boronobenzene-1,3-dicarboxylic acid |
| InChIKey | LCDXMCXNZRXUDH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dicarboxyphenylboronic acid, 5-boronoisophthalic acid, 3,5-Dicarboxybenzeneboronic acid, 5-boronobenzene-1,3-dicarboxylic acid, 5-boronoisophthalicacid, 3,5-Dicarboxyphenylboronic Acid (contains varying amounts of Anhydride), 1,3-Benzenedicarboxylic acid, 5-borono-, 3,5-Dicarboxyphenylboronic, 3,5-Dicarboxyphenylboronic acid(contains varying amounts of Anhydride)