cas: 1355241-50-7 — see every product listed under this CAS number, including other names
5-BroMo-2-chloro-thiazolo[5,4-b]pyridine, 98%, 98% (CAS 1355241-50-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110W7Y-50mg |
| cas | 1355241-50-7 |
| size | 50mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 232.40 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1005.20 Pln | |
| Chemat | 5g | 3333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-chloro-[1,3]thiazolo[5,4-b]pyridine (CAS 1355241-50-7) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 5-bromo-2-chloro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: SDZVRGYHXUIPEL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 5-bromo-2-chloro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | SDZVRGYHXUIPEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(S2)Cl)Br |
Computed by PubChem (NCBI)