CAS 1152475-42-7 appears in our catalog under these names: 7-Bromo-2-chlorothieno(3,2-d)pyrimidine, 7-Bromo-2-chlorothieno[3,2-d]pyrimidine, 98%, 7-Bromo-2-chlorothieno[3,2-d]pyrimidine 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg, 5g, 1g, 10g.
7-bromo-2-chlorothieno[3,2-d]pyrimidine (CAS 1152475-42-7) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 7-bromo-2-chlorothieno[3,2-d]pyrimidine. InChIKey: OJKRQQNUFWOJAV-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 7-bromo-2-chlorothieno[3,2-d]pyrimidine |
| InChIKey | OJKRQQNUFWOJAV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)Cl)C(=CS2)Br |
Computed by PubChem (NCBI)