cas: 914225-67-5 — see every product listed under this CAS number, including other names
5-Bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene 95% (CAS 914225-67-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270919-250mg |
| cas | 914225-67-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2450.75 Pln | |
| Ambeed | 100g | 7696.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270919 |
5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene (CAS 914225-67-5) is a chemical compound with the molecular formula C7H2BrClF4 and a molecular weight of 277.44 g/mol. IUPAC name: 5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: BBEDFMIZRIVTRI-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF4 |
|---|---|
| Molecular weight | 277.44 g/mol |
| IUPAC name | 5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | BBEDFMIZRIVTRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)Cl)Br |
Computed by PubChem (NCBI)