cas: 914225-67-5 — see every product listed under this CAS number, including other names
5-Bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene, 95%, 95% (CAS 914225-67-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUUF-250mg |
| cas | 914225-67-5 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 25g | 1355.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene (CAS 914225-67-5) is a chemical compound with the molecular formula C7H2BrClF4 and a molecular weight of 277.44 g/mol. IUPAC name: 5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: BBEDFMIZRIVTRI-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF4 |
|---|---|
| Molecular weight | 277.44 g/mol |
| IUPAC name | 5-bromo-1-chloro-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | BBEDFMIZRIVTRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)Cl)Br |
Computed by PubChem (NCBI)