CAS 1192037-87-8 appears in our catalog under these names: 5-Bromo-1-methylindole-2-boronic acid, pinacol ester, 95%, 5-Bromo-1-methylindole-2-boronic acid, pinacol ester, 95%, 95%, 5-Bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg.
5-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1192037-87-8) is a chemical compound with the molecular formula C15H19BBrNO2 and a molecular weight of 336.03 g/mol. IUPAC name: 5-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: GBAYEAQTJRVESZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BBrNO2 |
|---|---|
| Molecular weight | 336.03 g/mol |
| IUPAC name | 5-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | GBAYEAQTJRVESZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C)C=CC(=C3)Br |
Computed by PubChem (NCBI)