CAS 2377608-06-3 is the registry number for 6-Bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-indole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 2377608-06-3) is a chemical compound with the molecular formula C15H19BBrNO2 and a molecular weight of 336.03 g/mol. IUPAC name: 6-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: PLOKIUPSPWQDAY-UHFFFAOYSA-N.
| Molecular formula | C15H19BBrNO2 |
|---|---|
| Molecular weight | 336.03 g/mol |
| IUPAC name | 6-bromo-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | PLOKIUPSPWQDAY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C)C=C(C=C3)Br |
Computed by PubChem (NCBI)