cas: 261945-71-5 — see every product listed under this CAS number, including other names
5-Bromo-2,4-difluorobenzotrifluoride 97% (CAS 261945-71-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A997982-250mg |
| cas | 261945-71-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3140.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A997982 |
1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene (CAS 261945-71-5) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene. InChIKey: JSXBNFYUPDSZIN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | JSXBNFYUPDSZIN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)F)C(F)(F)F |
Computed by PubChem (NCBI)