cas: 261945-71-5 — see every product listed under this CAS number, including other names
Benzene, 1-bromo-2,4-difluoro-5-(trifluoromethyl)-, 98%, 98% (CAS 261945-71-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113S6N-250mg |
| cas | 261945-71-5 |
| size | 250mg |
| availability | 28.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene (CAS 261945-71-5) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene. InChIKey: JSXBNFYUPDSZIN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | JSXBNFYUPDSZIN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)F)C(F)(F)F |
Computed by PubChem (NCBI)