cas: 1826110-12-6 — see every product listed under this CAS number, including other names
5-Bromo-2,6-dimethoxypyridine-3-carboxylic acid (CAS 1826110-12-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631669-1G |
| cas | 1826110-12-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2715.73 Pln | |
| Fluorochem | 5g | 7995.12 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2,6-dimethoxypyridine-3-carboxylic acid (CAS 1826110-12-6) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 5-bromo-2,6-dimethoxypyridine-3-carboxylic acid. InChIKey: JKSPOJCCZWMMCA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 5-bromo-2,6-dimethoxypyridine-3-carboxylic acid |
| InChIKey | JKSPOJCCZWMMCA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C(=O)O)Br |
Computed by PubChem (NCBI)