cas: 1826110-12-6 — see every product listed under this CAS number, including other names
5-Bromo-2,6-dimethoxypyridine-3-carboxylic acid, ≥95%, ≥95% (CAS 1826110-12-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12M8XW-1g |
| cas | 1826110-12-6 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,6-dimethoxypyridine-3-carboxylic acid (CAS 1826110-12-6) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 5-bromo-2,6-dimethoxypyridine-3-carboxylic acid. InChIKey: JKSPOJCCZWMMCA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 5-bromo-2,6-dimethoxypyridine-3-carboxylic acid |
| InChIKey | JKSPOJCCZWMMCA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C(=O)O)Br |
Computed by PubChem (NCBI)