cas: 433683-47-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(2,2,2-trifluoroethoxy)pyrimidine, 98% (CAS 433683-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F638278-250MG |
| cas | 433683-47-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 4782.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine (CAS 433683-47-7) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine. InChIKey: CEPMXQTXQLBEDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine |
| InChIKey | CEPMXQTXQLBEDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)